C17H27NO2 — CID 62707741
2-[[methyl-[(5-methylfuran-2-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-one (PubChem CID 62707741) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[[methyl-[(5-methylfuran-2-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-one.
| Compound Name | 2-[[methyl-[(5-methylfuran-2-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 62707741 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[[methyl-[(5-methylfuran-2-yl)methyl]amino]methyl]-4-propan-2-ylcyclohexan-1-one |
| SMILES | Cc1ccc(CN(C)CC2CC(C(C)C)CCC2=O)o1 |
| InChI | InChI=1S/C17H27NO2/c1-12(2)14-6-8-17(19)15(9-14)10-18(4)11-16-7-5-13(3)20-16/h5,7,12,14-15H,6,8-11H2,1-4H3 |
| InChIKey | UYLLJLWPIANEIN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |