C13H24N2O — CID 82854049
1-N-methyl-1-N-[(5-methylfuran-2-yl)methyl]hexane-1,5-diamine (PubChem CID 82854049) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-N-methyl-1-N-[(5-methylfuran-2-yl)methyl]hexane-1,5-diamine.
| Compound Name | 1-N-methyl-1-N-[(5-methylfuran-2-yl)methyl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 82854049 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-N-methyl-1-N-[(5-methylfuran-2-yl)methyl]hexane-1,5-diamine |
| SMILES | Cc1ccc(CN(C)CCCCC(C)N)o1 |
| InChI | InChI=1S/C13H24N2O/c1-11(14)6-4-5-9-15(3)10-13-8-7-12(2)16-13/h7-8,11H,4-6,9-10,14H2,1-3H3 |
| InChIKey | YPFBFUGSNMHVSW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|