C12H19NO2 — CID 79396289
3-methyl-1-[methyl-[(5-methylfuran-2-yl)methyl]amino]butan-2-one (PubChem CID 79396289) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-methyl-1-[methyl-[(5-methylfuran-2-yl)methyl]amino]butan-2-one.
| Compound Name | 3-methyl-1-[methyl-[(5-methylfuran-2-yl)methyl]amino]butan-2-one |
|---|---|
| PubChem CID | 79396289 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-methyl-1-[methyl-[(5-methylfuran-2-yl)methyl]amino]butan-2-one |
| SMILES | Cc1ccc(CN(C)CC(=O)C(C)C)o1 |
| InChI | InChI=1S/C12H19NO2/c1-9(2)12(14)8-13(4)7-11-6-5-10(3)15-11/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | IJJIUJALUFVRDO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |