C14H18ClNO2 — CID 62708725
N-[[2-(7-chloro-1,3-benzodioxol-5-yl)cyclopropyl]methyl]propan-1-amine (PubChem CID 62708725) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is N-[[2-(7-chloro-1,3-benzodioxol-5-yl)cyclopropyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(7-chloro-1,3-benzodioxol-5-yl)cyclopropyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62708725 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[[2-(7-chloro-1,3-benzodioxol-5-yl)cyclopropyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CC1c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H18ClNO2/c1-2-3-16-7-10-4-11(10)9-5-12(15)14-13(6-9)17-8-18-14/h5-6,10-11,16H,2-4,7-8H2,1H3 |
| InChIKey | JJNVNZYCTXJEPR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|