C10H15ClN2S — CID 107125484
N-[[2-(5-chloro-1,3-thiazol-2-yl)cyclopropyl]methyl]propan-1-amine (PubChem CID 107125484) has the molecular formula C10H15ClN2S and a molecular weight of 230.76 g/mol. Its IUPAC name is N-[[2-(5-chloro-1,3-thiazol-2-yl)cyclopropyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(5-chloro-1,3-thiazol-2-yl)cyclopropyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107125484 |
| Molecular Formula | C10H15ClN2S |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | N-[[2-(5-chloro-1,3-thiazol-2-yl)cyclopropyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CC1c1ncc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2S/c1-2-3-12-5-7-4-8(7)10-13-6-9(11)14-10/h6-8,12H,2-5H2,1H3 |
| InChIKey | KZLNZDRTQFOWEY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|