C13H17F2N — CID 62704418
N-[[2-(2,6-difluorophenyl)cyclopropyl]methyl]propan-1-amine (PubChem CID 62704418) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is N-[[2-(2,6-difluorophenyl)cyclopropyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(2,6-difluorophenyl)cyclopropyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62704418 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[[2-(2,6-difluorophenyl)cyclopropyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CC1c1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2N/c1-2-6-16-8-9-7-10(9)13-11(14)4-3-5-12(13)15/h3-5,9-10,16H,2,6-8H2,1H3 |
| InChIKey | GQDKYZFBGNRFFZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|