C14H17FN4 — CID 62709909
2-(4-cyclohexyl-1,2,4-triazol-3-yl)-5-fluoroaniline (PubChem CID 62709909) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-5-fluoroaniline.
| Compound Name | 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 62709909 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-5-fluoroaniline |
| SMILES | Nc1cc(F)ccc1-c1nncn1C1CCCCC1 |
| InChI | InChI=1S/C14H17FN4/c15-10-6-7-12(13(16)8-10)14-18-17-9-19(14)11-4-2-1-3-5-11/h6-9,11H,1-5,16H2 |
| InChIKey | IPYGTKGEYMUZQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|