C9H14N4O2 — CID 62711461
3-[2-(dimethylamino)ethylamino]pyrazine-2-carboxylic acid (PubChem CID 62711461) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylamino]pyrazine-2-carboxylic acid.
| Compound Name | 3-[2-(dimethylamino)ethylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 62711461 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-[2-(dimethylamino)ethylamino]pyrazine-2-carboxylic acid |
| SMILES | CN(C)CCNc1nccnc1C(=O)O |
| InChI | InChI=1S/C9H14N4O2/c1-13(2)6-5-12-8-7(9(14)15)10-3-4-11-8/h3-4H,5-6H2,1-2H3,(H,11,12)(H,14,15) |
| InChIKey | GENJBHAPFLUFNP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |