C9H15N5S — CID 62684601
3-[2-(dimethylamino)ethylamino]pyrazine-2-carbothioamide (PubChem CID 62684601) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylamino]pyrazine-2-carbothioamide.
| Compound Name | 3-[2-(dimethylamino)ethylamino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 62684601 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-[2-(dimethylamino)ethylamino]pyrazine-2-carbothioamide |
| SMILES | CN(C)CCNc1nccnc1C(N)=S |
| InChI | InChI=1S/C9H15N5S/c1-14(2)6-5-13-9-7(8(10)15)11-3-4-12-9/h3-4H,5-6H2,1-2H3,(H2,10,15)(H,12,13) |
| InChIKey | XNMVEFRPAXLNKC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|