C8H13N5O2S2 — CID 106339226
3-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carbothioamide (PubChem CID 106339226) has the molecular formula C8H13N5O2S2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carbothioamide.
| Compound Name | 3-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 106339226 |
| Molecular Formula | C8H13N5O2S2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 3-[2-(methylsulfamoyl)ethylamino]pyrazine-2-carbothioamide |
| SMILES | CNS(=O)(=O)CCNc1nccnc1C(N)=S |
| InChI | InChI=1S/C8H13N5O2S2/c1-10-17(14,15)5-4-13-8-6(7(9)16)11-2-3-12-8/h2-3,10H,4-5H2,1H3,(H2,9,16)(H,12,13) |
| InChIKey | YBMAMONVFOSCGS-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|