C15H23N3 — CID 62712043
9-(2-pyridin-3-ylethyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 62712043) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 9-(2-pyridin-3-ylethyl)-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | 9-(2-pyridin-3-ylethyl)-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 62712043 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 9-(2-pyridin-3-ylethyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | NC1CC2CCCC(C1)N2CCc1cccnc1 |
| InChI | InChI=1S/C15H23N3/c16-13-9-14-4-1-5-15(10-13)18(14)8-6-12-3-2-7-17-11-12/h2-3,7,11,13-15H,1,4-6,8-10,16H2 |
| InChIKey | WEXODDIOVGMFLB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |