C13H19N3 — CID 61233276
8-(pyridin-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 61233276) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 8-(pyridin-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 8-(pyridin-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 61233276 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 8-(pyridin-3-ylmethyl)-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | NC1CC2CCC(C1)N2Cc1cccnc1 |
| InChI | InChI=1S/C13H19N3/c14-11-6-12-3-4-13(7-11)16(12)9-10-2-1-5-15-8-10/h1-2,5,8,11-13H,3-4,6-7,9,14H2 |
| InChIKey | XZBPTULNMOKYGD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |