C17H26N2S — CID 62712731
N-ethyl-9-(4-methylsulfanylphenyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 62712731) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is N-ethyl-9-(4-methylsulfanylphenyl)-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | N-ethyl-9-(4-methylsulfanylphenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 62712731 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-ethyl-9-(4-methylsulfanylphenyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CCNC1CC2CCCC(C1)N2c1ccc(SC)cc1 |
| InChI | InChI=1S/C17H26N2S/c1-3-18-13-11-15-5-4-6-16(12-13)19(15)14-7-9-17(20-2)10-8-14/h7-10,13,15-16,18H,3-6,11-12H2,1-2H3 |
| InChIKey | IGZHIFFCSACIFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |