C18H15F2N — CID 62715879
2-(2,3-difluorophenyl)-1-naphthalen-1-ylethanamine (PubChem CID 62715879) has the molecular formula C18H15F2N and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-naphthalen-1-ylethanamine.
| Compound Name | 2-(2,3-difluorophenyl)-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 62715879 |
| Molecular Formula | C18H15F2N |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-naphthalen-1-ylethanamine |
| SMILES | NC(Cc1cccc(F)c1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H15F2N/c19-16-10-4-7-13(18(16)20)11-17(21)15-9-3-6-12-5-1-2-8-14(12)15/h1-10,17H,11,21H2 |
| InChIKey | SAMBZPYSROWKMP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |