C15H21ClN2OS — CID 62720631
N-(2-amino-4-chlorophenyl)-2-(3-methylcyclohexyl)sulfanylacetamide (PubChem CID 62720631) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2-(3-methylcyclohexyl)sulfanylacetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2-(3-methylcyclohexyl)sulfanylacetamide |
|---|---|
| PubChem CID | 62720631 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2-(3-methylcyclohexyl)sulfanylacetamide |
| SMILES | CC1CCCC(SCC(=O)Nc2ccc(Cl)cc2N)C1 |
| InChI | InChI=1S/C15H21ClN2OS/c1-10-3-2-4-12(7-10)20-9-15(19)18-14-6-5-11(16)8-13(14)17/h5-6,8,10,12H,2-4,7,9,17H2,1H3,(H,18,19) |
| InChIKey | JALAZPXIOIMZHL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|