C14H17NO4S — CID 62720797
5-(3-methylcyclohexyl)sulfanyl-2-nitrobenzoic acid (PubChem CID 62720797) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-(3-methylcyclohexyl)sulfanyl-2-nitrobenzoic acid.
| Compound Name | 5-(3-methylcyclohexyl)sulfanyl-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 62720797 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-(3-methylcyclohexyl)sulfanyl-2-nitrobenzoic acid |
| SMILES | CC1CCCC(Sc2ccc([N+](=O)[O-])c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C14H17NO4S/c1-9-3-2-4-10(7-9)20-11-5-6-13(15(18)19)12(8-11)14(16)17/h5-6,8-10H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | LUCRKZASKFNUCD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|