C16H22N4 — CID 62723083
cyclohexyl-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 62723083) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is cyclohexyl-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | cyclohexyl-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 62723083 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | cyclohexyl-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | Cn1nc(-c2ccccc2)nc1C(N)C1CCCCC1 |
| InChI | InChI=1S/C16H22N4/c1-20-16(14(17)12-8-4-2-5-9-12)18-15(19-20)13-10-6-3-7-11-13/h3,6-7,10-12,14H,2,4-5,8-9,17H2,1H3 |
| InChIKey | NELVILKBQAUFCQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |