C12H21ClN2 — CID 171212592
(R)-cyclohexyl-(1-methylpyrrol-2-yl)methanamine;hydrochloride (PubChem CID 171212592) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is (R)-cyclohexyl-(1-methylpyrrol-2-yl)methanamine;hydrochloride.
| Compound Name | (R)-cyclohexyl-(1-methylpyrrol-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171212592 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (R)-cyclohexyl-(1-methylpyrrol-2-yl)methanamine;hydrochloride |
| SMILES | Cl.Cn1cccc1[C@H](N)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2.ClH/c1-14-9-5-8-11(14)12(13)10-6-3-2-4-7-10;/h5,8-10,12H,2-4,6-7,13H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | TZBKOILFQBRVGU-UTONKHPSSA-N |
| XLogP | 3.03 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |