C12H23N — CID 62725163
N-methyl-1-(2-propyl-2-bicyclo[2.2.1]heptanyl)methanamine (PubChem CID 62725163) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-methyl-1-(2-propyl-2-bicyclo[2.2.1]heptanyl)methanamine.
| Compound Name | N-methyl-1-(2-propyl-2-bicyclo[2.2.1]heptanyl)methanamine |
|---|---|
| PubChem CID | 62725163 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-methyl-1-(2-propyl-2-bicyclo[2.2.1]heptanyl)methanamine |
| SMILES | CCCC1(CNC)CC2CCC1C2 |
| InChI | InChI=1S/C12H23N/c1-3-6-12(9-13-2)8-10-4-5-11(12)7-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | FSRYZDOHTZLBBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |