C20H39N — CID 63520946
N-[(2-nonyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-1-amine (PubChem CID 63520946) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N-[(2-nonyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-1-amine.
| Compound Name | N-[(2-nonyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63520946 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N-[(2-nonyl-2-bicyclo[2.2.1]heptanyl)methyl]propan-1-amine |
| SMILES | CCCCCCCCCC1(CNCCC)CC2CCC1C2 |
| InChI | InChI=1S/C20H39N/c1-3-5-6-7-8-9-10-13-20(17-21-14-4-2)16-18-11-12-19(20)15-18/h18-19,21H,3-17H2,1-2H3 |
| InChIKey | YTPYAXHVSFSDAK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|