C9H15F3N2O3S — CID 62728775
2,2,2-trifluoro-1-(4-propylsulfonylpiperazin-1-yl)ethanone (PubChem CID 62728775) has the molecular formula C9H15F3N2O3S and a molecular weight of 288.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-propylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-propylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 62728775 |
| Molecular Formula | C9H15F3N2O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-propylsulfonylpiperazin-1-yl)ethanone |
| SMILES | CCCS(=O)(=O)N1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3N2O3S/c1-2-7-18(16,17)14-5-3-13(4-6-14)8(15)9(10,11)12/h2-7H2,1H3 |
| InChIKey | HOAJRNHFKGMMFJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |