C12H13ClFN5 — CID 62735977
N-[[1-[(3-chloro-4-fluorophenyl)methyl]tetrazol-5-yl]methyl]cyclopropanamine (PubChem CID 62735977) has the molecular formula C12H13ClFN5 and a molecular weight of 281.72 g/mol. Its IUPAC name is N-[[1-[(3-chloro-4-fluorophenyl)methyl]tetrazol-5-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[(3-chloro-4-fluorophenyl)methyl]tetrazol-5-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62735977 |
| Molecular Formula | C12H13ClFN5 |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[[1-[(3-chloro-4-fluorophenyl)methyl]tetrazol-5-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Cn2nnnc2CNC2CC2)cc1Cl |
| InChI | InChI=1S/C12H13ClFN5/c13-10-5-8(1-4-11(10)14)7-19-12(16-17-18-19)6-15-9-2-3-9/h1,4-5,9,15H,2-3,6-7H2 |
| InChIKey | VILRQDXTEXOSMQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |