C12H15BrClNO2 — CID 62736938
3,3-dimethylbutyl 5-bromo-2-chloropyridine-3-carboxylate (PubChem CID 62736938) has the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. Its IUPAC name is 3,3-dimethylbutyl 5-bromo-2-chloropyridine-3-carboxylate.
| Compound Name | 3,3-dimethylbutyl 5-bromo-2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 62736938 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 3,3-dimethylbutyl 5-bromo-2-chloropyridine-3-carboxylate |
| SMILES | CC(C)(C)CCOC(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C12H15BrClNO2/c1-12(2,3)4-5-17-11(16)9-6-8(13)7-15-10(9)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | QZWRMPLKZJLMMS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|