About 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate
3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate (PubChem CID 107382642) has the molecular formula C11H15ClN2O2
and a molecular weight of 242.71 g/mol. Its IUPAC name is 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate.
Molecular Properties
| Compound Name | 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate |
| PubChem CID | 107382642 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate |
| SMILES | CC(C)(C)CCOC(=O)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H15ClN2O2/c1-11(2,3)4-5-16-10(15)8-6-14-9(12)7-13-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | DCWIYRHDJHUYLK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate?
The IUPAC name of 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate (CID 107382642) is 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate.
What is the SMILES notation for 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate?
The canonical SMILES for 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate is CC(C)(C)CCOC(=O)c1cnc(Cl)cn1.
What is the InChIKey of 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate?
The InChIKey is DCWIYRHDJHUYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2/c1-11(2,3)4-5-16-10(15)8-6-14-9(12)7-13-8/h6-7H,4-5H2,1-3H3.
What are the key properties of 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate?
3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate has a molecular weight of 242.71 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl 5-chloropyrazine-2-carboxylate is sourced from PubChem (CID 107382642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).