C12H19F3O3 — CID 62738852
1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid (PubChem CID 62738852) has the molecular formula C12H19F3O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 62738852 |
| Molecular Formula | C12H19F3O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(CCCOCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C12H19F3O3/c13-12(14,15)9-18-8-4-7-11(10(16)17)5-2-1-3-6-11/h1-9H2,(H,16,17) |
| InChIKey | HCOUHORHSNGZBA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|