C14H13ClF3NO — CID 62740470
8-[2-chloro-5-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 62740470) has the molecular formula C14H13ClF3NO and a molecular weight of 303.71 g/mol. Its IUPAC name is 8-[2-chloro-5-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 8-[2-chloro-5-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 62740470 |
| Molecular Formula | C14H13ClF3NO |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 8-[2-chloro-5-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1CC2CCC(C1)N2c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H13ClF3NO/c15-12-4-1-8(14(16,17)18)5-13(12)19-9-2-3-10(19)7-11(20)6-9/h1,4-5,9-10H,2-3,6-7H2 |
| InChIKey | CJEFGQBYLSUVLZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |