C11H20N4O — CID 62742559
3-[(2-methyl-1H-imidazol-5-yl)methylamino]-N-propylpropanamide (PubChem CID 62742559) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-[(2-methyl-1H-imidazol-5-yl)methylamino]-N-propylpropanamide.
| Compound Name | 3-[(2-methyl-1H-imidazol-5-yl)methylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 62742559 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-[(2-methyl-1H-imidazol-5-yl)methylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNCc1cnc(C)[nH]1 |
| InChI | InChI=1S/C11H20N4O/c1-3-5-13-11(16)4-6-12-7-10-8-14-9(2)15-10/h8,12H,3-7H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | CSDRYDSRAOBUKK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|