C12H11ClF3N3 — CID 62742684
4-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)aniline (PubChem CID 62742684) has the molecular formula C12H11ClF3N3 and a molecular weight of 289.69 g/mol. Its IUPAC name is 4-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 62742684 |
| Molecular Formula | C12H11ClF3N3 |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-chloro-N-[(2-methyl-1H-imidazol-5-yl)methyl]-2-(trifluoromethyl)aniline |
| SMILES | Cc1ncc(CNc2ccc(Cl)cc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C12H11ClF3N3/c1-7-17-5-9(19-7)6-18-11-3-2-8(13)4-10(11)12(14,15)16/h2-5,18H,6H2,1H3,(H,17,19) |
| InChIKey | GFVSXASCBRXJPT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |