About 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine
1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine (PubChem CID 627434) has the molecular formula C19H18N4
and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine.
Molecular Properties
| Compound Name | 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine |
| PubChem CID | 627434 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine |
| SMILES | Cc1ccc(Nc2c3cc(C)ccc3nc3cnn(C)c23)cc1 |
| InChI | InChI=1S/C19H18N4/c1-12-4-7-14(8-5-12)21-18-15-10-13(2)6-9-16(15)22-17-11-20-23(3)19(17)18/h4-11H,1-3H3,(H,21,22) |
| InChIKey | GDZYBIJOOLGKAU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine?
The IUPAC name of 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine (CID 627434) is 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine.
What is the SMILES notation for 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine?
The canonical SMILES for 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine is Cc1ccc(Nc2c3cc(C)ccc3nc3cnn(C)c23)cc1.
What is the InChIKey of 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine?
The InChIKey is GDZYBIJOOLGKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4/c1-12-4-7-14(8-5-12)21-18-15-10-13(2)6-9-16(15)22-17-11-20-23(3)19(17)18/h4-11H,1-3H3,(H,21,22).
What are the key properties of 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine?
1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine has a molecular weight of 302.38 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine is sourced from PubChem (CID 627434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).