C19H18N4 — CID 627434
1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine (PubChem CID 627434) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine.
| Compound Name | 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine |
|---|---|
| PubChem CID | 627434 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,7-dimethyl-N-(4-methylphenyl)pyrazolo[4,3-b]quinolin-9-amine |
| SMILES | Cc1ccc(Nc2c3cc(C)ccc3nc3cnn(C)c23)cc1 |
| InChI | InChI=1S/C19H18N4/c1-12-4-7-14(8-5-12)21-18-15-10-13(2)6-9-16(15)22-17-11-20-23(3)19(17)18/h4-11H,1-3H3,(H,21,22) |
| InChIKey | GDZYBIJOOLGKAU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |