C9H9N3OS2 — CID 62750626
2-[methyl(1,3-thiazol-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde (PubChem CID 62750626) has the molecular formula C9H9N3OS2 and a molecular weight of 239.33 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62750626 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-1,3-thiazole-5-carbaldehyde |
| SMILES | CN(Cc1cscn1)c1ncc(C=O)s1 |
| InChI | InChI=1S/C9H9N3OS2/c1-12(3-7-5-14-6-11-7)9-10-2-8(4-13)15-9/h2,4-6H,3H2,1H3 |
| InChIKey | KEJSTSKOIKRYGQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|