C10H19N3S — CID 62750832
5-(1-aminoethyl)-N-butyl-N-methyl-1,3-thiazol-2-amine (PubChem CID 62750832) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 5-(1-aminoethyl)-N-butyl-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 5-(1-aminoethyl)-N-butyl-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62750832 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-(1-aminoethyl)-N-butyl-N-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCN(C)c1ncc(C(C)N)s1 |
| InChI | InChI=1S/C10H19N3S/c1-4-5-6-13(3)10-12-7-9(14-10)8(2)11/h7-8H,4-6,11H2,1-3H3 |
| InChIKey | UZAUQADNEQGNEG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |