C11H20N2OS — CID 62754020
1-[2-[methyl(pentyl)amino]-1,3-thiazol-5-yl]ethanol (PubChem CID 62754020) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 1-[2-[methyl(pentyl)amino]-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-[methyl(pentyl)amino]-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 62754020 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-[2-[methyl(pentyl)amino]-1,3-thiazol-5-yl]ethanol |
| SMILES | CCCCCN(C)c1ncc(C(C)O)s1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-5-6-7-13(3)11-12-8-10(15-11)9(2)14/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | RFOIUKRXTXCZTG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|