C12H20N2O2S — CID 62753865
1-[2-[methyl(oxan-2-ylmethyl)amino]-1,3-thiazol-5-yl]ethanol (PubChem CID 62753865) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-[2-[methyl(oxan-2-ylmethyl)amino]-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-[methyl(oxan-2-ylmethyl)amino]-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 62753865 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-[2-[methyl(oxan-2-ylmethyl)amino]-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(N(C)CC2CCCCO2)s1 |
| InChI | InChI=1S/C12H20N2O2S/c1-9(15)11-7-13-12(17-11)14(2)8-10-5-3-4-6-16-10/h7,9-10,15H,3-6,8H2,1-2H3 |
| InChIKey | QYEISVBBYYASFV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |