C12H19NO2S — CID 115090950
2-[2-(oxan-2-ylmethyl)-1,3-thiazol-5-yl]propan-1-ol (PubChem CID 115090950) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[2-(oxan-2-ylmethyl)-1,3-thiazol-5-yl]propan-1-ol.
| Compound Name | 2-[2-(oxan-2-ylmethyl)-1,3-thiazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 115090950 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[2-(oxan-2-ylmethyl)-1,3-thiazol-5-yl]propan-1-ol |
| SMILES | CC(CO)c1cnc(CC2CCCCO2)s1 |
| InChI | InChI=1S/C12H19NO2S/c1-9(8-14)11-7-13-12(16-11)6-10-4-2-3-5-15-10/h7,9-10,14H,2-6,8H2,1H3 |
| InChIKey | VGTFUTFSQBVNJI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |