C11H17NO2S — CID 115089925
2-[2-(oxan-4-yl)-1,3-thiazol-5-yl]propan-1-ol (PubChem CID 115089925) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[2-(oxan-4-yl)-1,3-thiazol-5-yl]propan-1-ol.
| Compound Name | 2-[2-(oxan-4-yl)-1,3-thiazol-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 115089925 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[2-(oxan-4-yl)-1,3-thiazol-5-yl]propan-1-ol |
| SMILES | CC(CO)c1cnc(C2CCOCC2)s1 |
| InChI | InChI=1S/C11H17NO2S/c1-8(7-13)10-6-12-11(15-10)9-2-4-14-5-3-9/h6,8-9,13H,2-5,7H2,1H3 |
| InChIKey | LDFLNXLRYJMYNT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |