C15H25N3OS — CID 62754591
N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3-thiazol-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62754591) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3-thiazol-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3-thiazol-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62754591 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[[2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3-thiazol-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnc(N2CCOC3CCCC32)s1 |
| InChI | InChI=1S/C15H25N3OS/c1-15(2,3)17-10-11-9-16-14(20-11)18-7-8-19-13-6-4-5-12(13)18/h9,12-13,17H,4-8,10H2,1-3H3 |
| InChIKey | JRVMLGBTBYKPTP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |