C14H25N3O — CID 62756194
2-[2-(methoxymethyl)-4,6-dimethylpyrimidin-5-yl]-N-propylpropan-1-amine (PubChem CID 62756194) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)-4,6-dimethylpyrimidin-5-yl]-N-propylpropan-1-amine.
| Compound Name | 2-[2-(methoxymethyl)-4,6-dimethylpyrimidin-5-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 62756194 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-[2-(methoxymethyl)-4,6-dimethylpyrimidin-5-yl]-N-propylpropan-1-amine |
| SMILES | CCCNCC(C)c1c(C)nc(COC)nc1C |
| InChI | InChI=1S/C14H25N3O/c1-6-7-15-8-10(2)14-11(3)16-13(9-18-5)17-12(14)4/h10,15H,6-9H2,1-5H3 |
| InChIKey | MUJBNLNJXDSEPX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|