C10H14N2OS — CID 62757246
2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 62757246) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62757246 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-(2-methylpiperidin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC1CCCCN1c1ncc(C=O)s1 |
| InChI | InChI=1S/C10H14N2OS/c1-8-4-2-3-5-12(8)10-11-6-9(7-13)14-10/h6-8H,2-5H2,1H3 |
| InChIKey | XMPGYYBBNVKION-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|