C13H15N3O2S — CID 62760382
N-(2-hydroxyethyl)-4-(1,3-thiazol-5-ylmethylamino)benzamide (PubChem CID 62760382) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-(1,3-thiazol-5-ylmethylamino)benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-(1,3-thiazol-5-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 62760382 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2-hydroxyethyl)-4-(1,3-thiazol-5-ylmethylamino)benzamide |
| SMILES | O=C(NCCO)c1ccc(NCc2cncs2)cc1 |
| InChI | InChI=1S/C13H15N3O2S/c17-6-5-15-13(18)10-1-3-11(4-2-10)16-8-12-7-14-9-19-12/h1-4,7,9,16-17H,5-6,8H2,(H,15,18) |
| InChIKey | LKVMFZUQZPADEP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |