C10H12N6O — CID 62761635
2-[4-(pyrazin-2-ylmethylamino)pyrazol-1-yl]acetamide (PubChem CID 62761635) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-[4-(pyrazin-2-ylmethylamino)pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-(pyrazin-2-ylmethylamino)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 62761635 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[4-(pyrazin-2-ylmethylamino)pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(NCc2cnccn2)cn1 |
| InChI | InChI=1S/C10H12N6O/c11-10(17)7-16-6-9(5-15-16)14-4-8-3-12-1-2-13-8/h1-3,5-6,14H,4,7H2,(H2,11,17) |
| InChIKey | CGZMPWLRZRCCLG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |