C10H9ClIN3 — CID 62761938
2-chloro-N-(1H-imidazol-5-ylmethyl)-4-iodoaniline (PubChem CID 62761938) has the molecular formula C10H9ClIN3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-chloro-N-(1H-imidazol-5-ylmethyl)-4-iodoaniline.
| Compound Name | 2-chloro-N-(1H-imidazol-5-ylmethyl)-4-iodoaniline |
|---|---|
| PubChem CID | 62761938 |
| Molecular Formula | C10H9ClIN3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | 2-chloro-N-(1H-imidazol-5-ylmethyl)-4-iodoaniline |
| SMILES | Clc1cc(I)ccc1NCc1cnc[nH]1 |
| InChI | InChI=1S/C10H9ClIN3/c11-9-3-7(12)1-2-10(9)14-5-8-4-13-6-15-8/h1-4,6,14H,5H2,(H,13,15) |
| InChIKey | DOJMZMCOSRXGDJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|