C12H13ClIN3 — CID 43733817
2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-iodoaniline (PubChem CID 43733817) has the molecular formula C12H13ClIN3 and a molecular weight of 361.61 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-iodoaniline.
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-iodoaniline |
|---|---|
| PubChem CID | 43733817 |
| Molecular Formula | C12H13ClIN3 |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-4-iodoaniline |
| SMILES | Cc1n[nH]c(C)c1CNc1ccc(I)cc1Cl |
| InChI | InChI=1S/C12H13ClIN3/c1-7-10(8(2)17-16-7)6-15-12-4-3-9(14)5-11(12)13/h3-5,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | ZKQMGSSAMODPGZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|