C11H12ClIN4O2S — CID 106006895
3-(aminomethyl)-N-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 106006895) has the molecular formula C11H12ClIN4O2S and a molecular weight of 426.67 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | 3-(aminomethyl)-N-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106006895 |
| Molecular Formula | C11H12ClIN4O2S |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 425.94 |
| IUPAC Name | 3-(aminomethyl)-N-(2-chloro-4-iodophenyl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(CN)c1S(=O)(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C11H12ClIN4O2S/c1-6-11(10(5-14)16-15-6)20(18,19)17-9-3-2-7(13)4-8(9)12/h2-4,17H,5,14H2,1H3,(H,15,16) |
| InChIKey | FMXXZKLWIDOINR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|