C12H12Cl3N3 — CID 43644783
2,4,5-trichloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 43644783) has the molecular formula C12H12Cl3N3 and a molecular weight of 304.61 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 2,4,5-trichloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43644783 |
| Molecular Formula | C12H12Cl3N3 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 2,4,5-trichloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Cc1n[nH]c(C)c1CNc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl3N3/c1-6-8(7(2)18-17-6)5-16-12-4-10(14)9(13)3-11(12)15/h3-4,16H,5H2,1-2H3,(H,17,18) |
| InChIKey | WAGNLIKTZNXCCO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|