About 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline
2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline (PubChem CID 43645020) has the molecular formula C13H13ClF3N3
and a molecular weight of 303.71 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline |
| PubChem CID | 43645020 |
| Molecular Formula | C13H13ClF3N3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline |
| SMILES | Cc1n[nH]c(C)c1CNc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C13H13ClF3N3/c1-7-9(8(2)20-19-7)6-18-12-10(13(15,16)17)4-3-5-11(12)14/h3-5,18H,6H2,1-2H3,(H,19,20) |
| InChIKey | DMYNXRCBJDBTBY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline?
The IUPAC name of 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline (CID 43645020) is 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline.
What is the SMILES notation for 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline?
The canonical SMILES for 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline is Cc1n[nH]c(C)c1CNc1c(Cl)cccc1C(F)(F)F.
What is the InChIKey of 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline?
The InChIKey is DMYNXRCBJDBTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF3N3/c1-7-9(8(2)20-19-7)6-18-12-10(13(15,16)17)4-3-5-11(12)14/h3-5,18H,6H2,1-2H3,(H,19,20).
What are the key properties of 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline?
2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline has a molecular weight of 303.71 g/mol, XLogP of 4.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-6-(trifluoromethyl)aniline is sourced from PubChem (CID 43645020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).