C14H16N2S — CID 62766078
5-[(3-methylphenyl)methylsulfanylmethyl]pyridin-2-amine (PubChem CID 62766078) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 5-[(3-methylphenyl)methylsulfanylmethyl]pyridin-2-amine.
| Compound Name | 5-[(3-methylphenyl)methylsulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62766078 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 5-[(3-methylphenyl)methylsulfanylmethyl]pyridin-2-amine |
| SMILES | Cc1cccc(CSCc2ccc(N)nc2)c1 |
| InChI | InChI=1S/C14H16N2S/c1-11-3-2-4-12(7-11)9-17-10-13-5-6-14(15)16-8-13/h2-8H,9-10H2,1H3,(H2,15,16) |
| InChIKey | WGBGWNAKAYIXIL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |