C13H14N2S — CID 80652578
6-[(3-methylphenyl)methylsulfanyl]pyridin-2-amine (PubChem CID 80652578) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 6-[(3-methylphenyl)methylsulfanyl]pyridin-2-amine.
| Compound Name | 6-[(3-methylphenyl)methylsulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 80652578 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-[(3-methylphenyl)methylsulfanyl]pyridin-2-amine |
| SMILES | Cc1cccc(CSc2cccc(N)n2)c1 |
| InChI | InChI=1S/C13H14N2S/c1-10-4-2-5-11(8-10)9-16-13-7-3-6-12(14)15-13/h2-8H,9H2,1H3,(H2,14,15) |
| InChIKey | CKUTYCVSDXEZGK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |