C15H26N4OS — CID 62767419
N-[[2-(4-cyclopropylpiperazin-1-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 62767419) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is N-[[2-(4-cyclopropylpiperazin-1-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(4-cyclopropylpiperazin-1-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62767419 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[[2-(4-cyclopropylpiperazin-1-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1sc(N2CCN(C3CC3)CC2)nc1C |
| InChI | InChI=1S/C15H26N4OS/c1-12-14(11-16-5-10-20-2)21-15(17-12)19-8-6-18(7-9-19)13-3-4-13/h13,16H,3-11H2,1-2H3 |
| InChIKey | OCYGGQRJTSRARH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|