C16H28N4S — CID 79935765
N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methylpropan-1-amine (PubChem CID 79935765) has the molecular formula C16H28N4S and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79935765 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,3-thiazol-5-yl]methyl]-2-methylpropan-1-amine |
| SMILES | Cc1nc(N2CCN3CCCC3C2)sc1CNCC(C)C |
| InChI | InChI=1S/C16H28N4S/c1-12(2)9-17-10-15-13(3)18-16(21-15)20-8-7-19-6-4-5-14(19)11-20/h12,14,17H,4-11H2,1-3H3 |
| InChIKey | CWACMYIRRJQQBP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |