C15H25N3OS — CID 79937237
[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-tert-butyl-1,3-thiazol-5-yl]methanol (PubChem CID 79937237) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-tert-butyl-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-tert-butyl-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 79937237 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-tert-butyl-1,3-thiazol-5-yl]methanol |
| SMILES | CC(C)(C)c1nc(N2CCN3CCCC3C2)sc1CO |
| InChI | InChI=1S/C15H25N3OS/c1-15(2,3)13-12(10-19)20-14(16-13)18-8-7-17-6-4-5-11(17)9-18/h11,19H,4-10H2,1-3H3 |
| InChIKey | NXPZHLUPLRYOTM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |